C17H17NO2 — CID 124802079
(4R)-5,5-dimethyl-2-oxido-3,4-diphenyl-4H-1,2-oxazol-2-ium (PubChem CID 124802079) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-2-oxido-3,4-diphenyl-4H-1,2-oxazol-2-ium.
| Compound Name | (4R)-5,5-dimethyl-2-oxido-3,4-diphenyl-4H-1,2-oxazol-2-ium |
|---|---|
| PubChem CID | 124802079 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (4R)-5,5-dimethyl-2-oxido-3,4-diphenyl-4H-1,2-oxazol-2-ium |
| SMILES | CC1(C)O[N+]([O-])=C(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-17(2)15(13-9-5-3-6-10-13)16(18(19)20-17)14-11-7-4-8-12-14/h3-12,15H,1-2H3/t15-/m1/s1 |
| InChIKey | LJLOIYSQJVMXDN-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |