C19H30F3NO5SSi — CID 11397241
tert-butyl-[(6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]-dimethylsilane;trifluoromethanesulfonate (PubChem CID 11397241) has the molecular formula C19H30F3NO5SSi and a molecular weight of 469.60 g/mol. Its IUPAC name is tert-butyl-[(6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]-dimethylsilane;trifluoromethanesulfonate.
| Compound Name | tert-butyl-[(6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]-dimethylsilane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11397241 |
| Molecular Formula | C19H30F3NO5SSi |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | tert-butyl-[(6,6-dimethyl-4-phenyl-4,5-dihydrooxazin-2-ium-2-yl)oxy]-dimethylsilane;trifluoromethanesulfonate |
| SMILES | CC1(C)CC(c2ccccc2)C=[N+](O[Si](C)(C)C(C)(C)C)O1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C18H30NO2Si.CHF3O3S/c1-17(2,3)22(6,7)21-19-14-16(13-18(4,5)20-19)15-11-9-8-10-12-15;2-1(3,4)8(5,6)7/h8-12,14,16H,13H2,1-7H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | RMMWAQLQMNLVCH-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|