C25H38O3Si — CID 15402494
4-[3-[2-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-phenylcyclopropyl]propyl]cyclohex-2-en-1-one (PubChem CID 15402494) has the molecular formula C25H38O3Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 4-[3-[2-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-phenylcyclopropyl]propyl]cyclohex-2-en-1-one.
| Compound Name | 4-[3-[2-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-phenylcyclopropyl]propyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 15402494 |
| Molecular Formula | C25H38O3Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 4-[3-[2-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-1-phenylcyclopropyl]propyl]cyclohex-2-en-1-one |
| SMILES | COC1(O[Si](C)(C)C(C)(C)C)CC1(CCCC1C=CC(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H38O3Si/c1-23(2,3)29(5,6)28-25(27-4)19-24(25,21-12-8-7-9-13-21)18-10-11-20-14-16-22(26)17-15-20/h7-9,12-14,16,20H,10-11,15,17-19H2,1-6H3 |
| InChIKey | MONRZFBWVGIVMU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|