C19H33NO2Si — CID 134924163
tert-butyl-dimethyl-[[(3S,5S)-2-methyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy]silane (PubChem CID 134924163) has the molecular formula C19H33NO2Si and a molecular weight of 335.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3S,5S)-2-methyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3S,5S)-2-methyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy]silane |
|---|---|
| PubChem CID | 134924163 |
| Molecular Formula | C19H33NO2Si |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(3S,5S)-2-methyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy]silane |
| SMILES | CC(C)[C@@H]1C[C@](O[Si](C)(C)C(C)(C)C)(c2ccccc2)ON1C |
| InChI | InChI=1S/C19H33NO2Si/c1-15(2)17-14-19(21-20(17)6,16-12-10-9-11-13-16)22-23(7,8)18(3,4)5/h9-13,15,17H,14H2,1-8H3/t17-,19-/m0/s1 |
| InChIKey | ORCBXWJKDLWKDJ-HKUYNNGSSA-N |
| XLogP | 5.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|