C16H26O2Si — CID 10378846
[(1S,2S)-1-methoxy-2-phenyl-2-propan-2-ylcyclopropyl]oxy-trimethylsilane (PubChem CID 10378846) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is [(1S,2S)-1-methoxy-2-phenyl-2-propan-2-ylcyclopropyl]oxy-trimethylsilane.
| Compound Name | [(1S,2S)-1-methoxy-2-phenyl-2-propan-2-ylcyclopropyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10378846 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | [(1S,2S)-1-methoxy-2-phenyl-2-propan-2-ylcyclopropyl]oxy-trimethylsilane |
| SMILES | CO[C@]1(O[Si](C)(C)C)C[C@@]1(c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H26O2Si/c1-13(2)15(14-10-8-7-9-11-14)12-16(15,17-3)18-19(4,5)6/h7-11,13H,12H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | CCGOEBAQGQMAIA-HOTGVXAUSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|