C16H28O2Si2 — CID 102015524
trimethyl-[(1R,2R)-1-methyl-2-phenyl-2-trimethylsilyloxycyclopropyl]oxysilane (PubChem CID 102015524) has the molecular formula C16H28O2Si2 and a molecular weight of 308.57 g/mol. Its IUPAC name is trimethyl-[(1R,2R)-1-methyl-2-phenyl-2-trimethylsilyloxycyclopropyl]oxysilane.
| Compound Name | trimethyl-[(1R,2R)-1-methyl-2-phenyl-2-trimethylsilyloxycyclopropyl]oxysilane |
|---|---|
| PubChem CID | 102015524 |
| Molecular Formula | C16H28O2Si2 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | trimethyl-[(1R,2R)-1-methyl-2-phenyl-2-trimethylsilyloxycyclopropyl]oxysilane |
| SMILES | C[C@@]1(O[Si](C)(C)C)C[C@@]1(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H28O2Si2/c1-15(17-19(2,3)4)13-16(15,18-20(5,6)7)14-11-9-8-10-12-14/h8-12H,13H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | HBKJPWYTCOFFTM-HZPDHXFCSA-N |
| XLogP | 4.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|