C15H24O2Si — CID 10956424
cis-(1R,2S)-2-phenyl-1-propan-2-yl-2-trimethylsilyloxycyclopropan-1-ol (PubChem CID 10956424) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is cis-(1R,2S)-2-phenyl-1-propan-2-yl-2-trimethylsilyloxycyclopropan-1-ol.
| Compound Name | cis-(1R,2S)-2-phenyl-1-propan-2-yl-2-trimethylsilyloxycyclopropan-1-ol |
|---|---|
| PubChem CID | 10956424 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | cis-(1R,2S)-2-phenyl-1-propan-2-yl-2-trimethylsilyloxycyclopropan-1-ol |
| SMILES | CC(C)[C@]1(O)C[C@]1(O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C15H24O2Si/c1-12(2)14(16)11-15(14,17-18(3,4)5)13-9-7-6-8-10-13/h6-10,12,16H,11H2,1-5H3/t14-,15+/m1/s1 |
| InChIKey | HQLLIMHCHXEMRM-CABCVRRESA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|