About methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate
methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate (PubChem CID 79299180) has the molecular formula C16H22O3
and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate |
| PubChem CID | 79299180 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate |
| SMILES | COC(=O)C1(C(C)C)OC1(c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H22O3/c1-11(2)15(13-9-7-6-8-10-13)16(19-15,12(3)4)14(17)18-5/h6-12H,1-5H3 |
| InChIKey | JDCFEZLAVZZBFC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate?
The IUPAC name of methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate (CID 79299180) is methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate.
What is the SMILES notation for methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate?
The canonical SMILES for methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate is COC(=O)C1(C(C)C)OC1(c1ccccc1)C(C)C.
What is the InChIKey of methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate?
The InChIKey is JDCFEZLAVZZBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-11(2)15(13-9-7-6-8-10-13)16(19-15,12(3)4)14(17)18-5/h6-12H,1-5H3.
What are the key properties of methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate?
methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate has a molecular weight of 262.35 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate is sourced from PubChem (CID 79299180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).