C16H22O3 — CID 79299180
methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate (PubChem CID 79299180) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate.
| Compound Name | methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate |
|---|---|
| PubChem CID | 79299180 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl 3-phenyl-2,3-di(propan-2-yl)oxirane-2-carboxylate |
| SMILES | COC(=O)C1(C(C)C)OC1(c1ccccc1)C(C)C |
| InChI | InChI=1S/C16H22O3/c1-11(2)15(13-9-7-6-8-10-13)16(19-15,12(3)4)14(17)18-5/h6-12H,1-5H3 |
| InChIKey | JDCFEZLAVZZBFC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|