C24H36F2O2Si2 — CID 159886663
(2,2-difluoro-1-phenylcyclopropyl)oxy-trimethylsilane;methane;trimethyl(1-phenylethenoxy)silane (PubChem CID 159886663) has the molecular formula C24H36F2O2Si2 and a molecular weight of 450.72 g/mol. Its IUPAC name is (2,2-difluoro-1-phenylcyclopropyl)oxy-trimethylsilane;methane;trimethyl(1-phenylethenoxy)silane.
| Compound Name | (2,2-difluoro-1-phenylcyclopropyl)oxy-trimethylsilane;methane;trimethyl(1-phenylethenoxy)silane |
|---|---|
| PubChem CID | 159886663 |
| Molecular Formula | C24H36F2O2Si2 |
| Molecular Weight | 450.72 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (2,2-difluoro-1-phenylcyclopropyl)oxy-trimethylsilane;methane;trimethyl(1-phenylethenoxy)silane |
| SMILES | C.C=C(O[Si](C)(C)C)c1ccccc1.C[Si](C)(C)OC1(c2ccccc2)CC1(F)F |
| InChI | InChI=1S/C12H16F2OSi.C11H16OSi.CH4/c1-16(2,3)15-11(9-12(11,13)14)10-7-5-4-6-8-10;1-10(12-13(2,3)4)11-8-6-5-7-9-11;/h4-8H,9H2,1-3H3;5-9H,1H2,2-4H3;1H4 |
| InChIKey | NUFKNNBLAKCTGZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.72 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|