C24H30O6 — CID 171625530
(2S)-2,3-bis(1-phenylethenoxy)butanedioic acid;ethane (PubChem CID 171625530) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S)-2,3-bis(1-phenylethenoxy)butanedioic acid;ethane.
| Compound Name | (2S)-2,3-bis(1-phenylethenoxy)butanedioic acid;ethane |
|---|---|
| PubChem CID | 171625530 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2S)-2,3-bis(1-phenylethenoxy)butanedioic acid;ethane |
| SMILES | C=C(OC(C(=O)O)[C@H](OC(=C)c1ccccc1)C(=O)O)c1ccccc1.CC.CC |
| InChI | InChI=1S/C20H18O6.2C2H6/c1-13(15-9-5-3-6-10-15)25-17(19(21)22)18(20(23)24)26-14(2)16-11-7-4-8-12-16;2*1-2/h3-12,17-18H,1-2H2,(H,21,22)(H,23,24);2*1-2H3/t17-,18?;;/m0../s1 |
| InChIKey | BOKGTFPQXSAHPA-SEFHDJSNSA-N |
| XLogP | 5.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|