C29H40O3Si — CID 101428155
[7a-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-phenylmethanone (PubChem CID 101428155) has the molecular formula C29H40O3Si and a molecular weight of 464.72 g/mol. Its IUPAC name is [7a-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-phenylmethanone.
| Compound Name | [7a-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101428155 |
| Molecular Formula | C29H40O3Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [7a-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-phenylmethanone |
| SMILES | COc1ccc(C2CC(C(=O)c3ccccc3)C3(O[Si](C)(C)C(C)(C)C)CCCCC23)cc1 |
| InChI | InChI=1S/C29H40O3Si/c1-28(2,3)33(5,6)32-29-19-11-10-14-25(29)24(21-15-17-23(31-4)18-16-21)20-26(29)27(30)22-12-8-7-9-13-22/h7-9,12-13,15-18,24-26H,10-11,14,19-20H2,1-6H3 |
| InChIKey | GMRHPTOMYNDJGR-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|