C23H34O4Si — CID 10916444
methyl (4R,4aS,8aR)-8a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate (PubChem CID 10916444) has the molecular formula C23H34O4Si and a molecular weight of 402.61 g/mol. Its IUPAC name is methyl (4R,4aS,8aR)-8a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate.
| Compound Name | methyl (4R,4aS,8aR)-8a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 10916444 |
| Molecular Formula | C23H34O4Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | methyl (4R,4aS,8aR)-8a-[tert-butyl(dimethyl)silyl]oxy-4-phenyl-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2ccccc2)[C@@H]2CCCC[C@]2(O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H34O4Si/c1-22(2,3)28(5,6)27-23-15-11-10-14-19(23)18(17-12-8-7-9-13-17)16-20(26-23)21(24)25-4/h7-9,12-13,16,18-19H,10-11,14-15H2,1-6H3/t18-,19-,23+/m0/s1 |
| InChIKey | GMJDXTABALILPA-SFYKDHMMSA-N |
| XLogP | 5.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|