C21H30O5Si — CID 91058414
methyl (3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 91058414) has the molecular formula C21H30O5Si and a molecular weight of 390.55 g/mol. Its IUPAC name is methyl (3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 91058414 |
| Molecular Formula | C21H30O5Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | methyl (3aR,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2OC(c3ccccc3)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H30O5Si/c1-21(2,3)27(5,6)26-17-13-15(19(22)23-4)12-16-18(17)25-20(24-16)14-10-8-7-9-11-14/h7-12,16-18,20H,13H2,1-6H3/t16-,17-,18-,20?/m1/s1 |
| InChIKey | JGDNCEUHCAPSLR-KYJJNMIMSA-N |
| XLogP | 4.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|