C20H28O4Si — CID 12072267
methyl (4S,4aR,8aR)-4-phenyl-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate (PubChem CID 12072267) has the molecular formula C20H28O4Si and a molecular weight of 360.53 g/mol. Its IUPAC name is methyl (4S,4aR,8aR)-4-phenyl-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate.
| Compound Name | methyl (4S,4aR,8aR)-4-phenyl-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate |
|---|---|
| PubChem CID | 12072267 |
| Molecular Formula | C20H28O4Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl (4S,4aR,8aR)-4-phenyl-8a-trimethylsilyloxy-4,4a,5,6,7,8-hexahydrochromene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccccc2)[C@H]2CCCC[C@]2(O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C20H28O4Si/c1-22-19(21)18-14-16(15-10-6-5-7-11-15)17-12-8-9-13-20(17,23-18)24-25(2,3)4/h5-7,10-11,14,16-17H,8-9,12-13H2,1-4H3/t16-,17-,20-/m1/s1 |
| InChIKey | RIQHDRLWKMCREY-MBOZVWFJSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|