C18H27NO2Si — CID 14590234
trimethyl-[(3-phenyl-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[e]oxazin-9a-yl)oxy]silane (PubChem CID 14590234) has the molecular formula C18H27NO2Si and a molecular weight of 317.50 g/mol. Its IUPAC name is trimethyl-[(3-phenyl-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[e]oxazin-9a-yl)oxy]silane.
| Compound Name | trimethyl-[(3-phenyl-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[e]oxazin-9a-yl)oxy]silane |
|---|---|
| PubChem CID | 14590234 |
| Molecular Formula | C18H27NO2Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | trimethyl-[(3-phenyl-4a,5,6,7,8,9-hexahydro-4H-cyclohepta[e]oxazin-9a-yl)oxy]silane |
| SMILES | C[Si](C)(C)OC12CCCCCC1CC(c1ccccc1)=NO2 |
| InChI | InChI=1S/C18H27NO2Si/c1-22(2,3)21-18-13-9-5-8-12-16(18)14-17(19-20-18)15-10-6-4-7-11-15/h4,6-7,10-11,16H,5,8-9,12-14H2,1-3H3 |
| InChIKey | DFBURYDNLOVSCD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|