C14H17NO — CID 101487996
(1S,5R)-1-methyl-3-phenyl-9-oxa-2-azabicyclo[3.3.1]non-2-ene (PubChem CID 101487996) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (1S,5R)-1-methyl-3-phenyl-9-oxa-2-azabicyclo[3.3.1]non-2-ene.
| Compound Name | (1S,5R)-1-methyl-3-phenyl-9-oxa-2-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 101487996 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (1S,5R)-1-methyl-3-phenyl-9-oxa-2-azabicyclo[3.3.1]non-2-ene |
| SMILES | C[C@]12CCC[C@H](CC(c3ccccc3)=N1)O2 |
| InChI | InChI=1S/C14H17NO/c1-14-9-5-8-12(16-14)10-13(15-14)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3/t12-,14+/m1/s1 |
| InChIKey | BUEOGAQBKUSABG-OCCSQVGLSA-N |
| XLogP | 3.16 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |