C21H34OSi — CID 10687915
[(1R,2R)-1-ethenyl-2-(3-phenylpropyl)cycloheptyl]oxy-trimethylsilane (PubChem CID 10687915) has the molecular formula C21H34OSi and a molecular weight of 330.59 g/mol. Its IUPAC name is [(1R,2R)-1-ethenyl-2-(3-phenylpropyl)cycloheptyl]oxy-trimethylsilane.
| Compound Name | [(1R,2R)-1-ethenyl-2-(3-phenylpropyl)cycloheptyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10687915 |
| Molecular Formula | C21H34OSi |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(1R,2R)-1-ethenyl-2-(3-phenylpropyl)cycloheptyl]oxy-trimethylsilane |
| SMILES | C=C[C@]1(O[Si](C)(C)C)CCCCC[C@@H]1CCCc1ccccc1 |
| InChI | InChI=1S/C21H34OSi/c1-5-21(22-23(2,3)4)18-11-7-10-16-20(21)17-12-15-19-13-8-6-9-14-19/h5-6,8-9,13-14,20H,1,7,10-12,15-18H2,2-4H3/t20-,21+/m1/s1 |
| InChIKey | RDFINYCJFUZRCZ-RTWAWAEBSA-N |
| XLogP | 6.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|