C26H38O4 — CID 102462320
1,1-dicyclohexylethyl (2S,3R)-3-(4-methoxyphenyl)oxolane-2-carboxylate (PubChem CID 102462320) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1,1-dicyclohexylethyl (2S,3R)-3-(4-methoxyphenyl)oxolane-2-carboxylate.
| Compound Name | 1,1-dicyclohexylethyl (2S,3R)-3-(4-methoxyphenyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 102462320 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 1,1-dicyclohexylethyl (2S,3R)-3-(4-methoxyphenyl)oxolane-2-carboxylate |
| SMILES | COc1ccc([C@H]2CCO[C@@H]2C(=O)OC(C)(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H38O4/c1-26(20-9-5-3-6-10-20,21-11-7-4-8-12-21)30-25(27)24-23(17-18-29-24)19-13-15-22(28-2)16-14-19/h13-16,20-21,23-24H,3-12,17-18H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | IPJFUJXYXHXSIE-RPWUZVMVSA-N |
| XLogP | 6.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |