C20H30O2Si — CID 10980442
(1S,8S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-10-methylidenetricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-ol (PubChem CID 10980442) has the molecular formula C20H30O2Si and a molecular weight of 330.54 g/mol. Its IUPAC name is (1S,8S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-10-methylidenetricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-ol.
| Compound Name | (1S,8S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-10-methylidenetricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-ol |
|---|---|
| PubChem CID | 10980442 |
| Molecular Formula | C20H30O2Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (1S,8S,9R)-1-[tert-butyl(dimethyl)silyl]oxy-10-methylidenetricyclo[7.3.1.02,7]trideca-2,4,6-trien-8-ol |
| SMILES | C=C1CC[C@]2(O[Si](C)(C)C(C)(C)C)C[C@H]1[C@H](O)c1ccccc12 |
| InChI | InChI=1S/C20H30O2Si/c1-14-11-12-20(22-23(5,6)19(2,3)4)13-16(14)18(21)15-9-7-8-10-17(15)20/h7-10,16,18,21H,1,11-13H2,2-6H3/t16-,18-,20+/m1/s1 |
| InChIKey | ZHDZLEZTSIXTEK-POAQFYNOSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|