C23H27F6NO2Si — CID 528739
N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 528739) has the molecular formula C23H27F6NO2Si and a molecular weight of 491.55 g/mol. Its IUPAC name is N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 528739 |
| Molecular Formula | C23H27F6NO2Si |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H27F6NO2Si/c1-21(2,3)33(4,5)32-19-8-6-15(7-9-19)10-11-30-20(31)16-12-17(22(24,25)26)14-18(13-16)23(27,28)29/h6-9,12-14H,10-11H2,1-5H3,(H,30,31) |
| InChIKey | XFEUWHPUEQTYBS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|