C20H21F6NO2Si — CID 526021
3,5-bis(trifluoromethyl)-N-[2-(4-trimethylsilyloxyphenyl)ethyl]benzamide (PubChem CID 526021) has the molecular formula C20H21F6NO2Si and a molecular weight of 449.47 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)-N-[2-(4-trimethylsilyloxyphenyl)ethyl]benzamide.
| Compound Name | 3,5-bis(trifluoromethyl)-N-[2-(4-trimethylsilyloxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 526021 |
| Molecular Formula | C20H21F6NO2Si |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3,5-bis(trifluoromethyl)-N-[2-(4-trimethylsilyloxyphenyl)ethyl]benzamide |
| SMILES | C[Si](C)(C)Oc1ccc(CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H21F6NO2Si/c1-30(2,3)29-17-6-4-13(5-7-17)8-9-27-18(28)14-10-15(19(21,22)23)12-16(11-14)20(24,25)26/h4-7,10-12H,8-9H2,1-3H3,(H,27,28) |
| InChIKey | TVDFVURRXDLERZ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|