C21H27FN2O5S — CID 126277699
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-methylbutyl)acetamide (PubChem CID 126277699) has the molecular formula C21H27FN2O5S and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 126277699 |
| Molecular Formula | C21H27FN2O5S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-(3-methylbutyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCC(C)C)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C21H27FN2O5S/c1-15(2)11-12-23-21(25)14-24(17-7-5-16(22)6-8-17)30(26,27)18-9-10-19(28-3)20(13-18)29-4/h5-10,13,15H,11-12,14H2,1-4H3,(H,23,25) |
| InChIKey | MIYCCRAZOXAWPL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |