C16H25N3O5S2 — CID 9286924
ethyl 2-[2-[2-(dimethylamino)-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]sulfanylacetate (PubChem CID 9286924) has the molecular formula C16H25N3O5S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is ethyl 2-[2-[2-(dimethylamino)-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-[2-(dimethylamino)-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 9286924 |
| Molecular Formula | C16H25N3O5S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl 2-[2-[2-(dimethylamino)-5-(dimethylsulfamoyl)anilino]-2-oxoethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(=O)Nc1cc(S(=O)(=O)N(C)C)ccc1N(C)C |
| InChI | InChI=1S/C16H25N3O5S2/c1-6-24-16(21)11-25-10-15(20)17-13-9-12(26(22,23)19(4)5)7-8-14(13)18(2)3/h7-9H,6,10-11H2,1-5H3,(H,17,20) |
| InChIKey | KKHQOQQWBIBFGW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |