C7H3Cl3N2O3 — CID 22150912
N-(3,5-dichloro-4-nitrophenyl)carbamoyl chloride (PubChem CID 22150912) has the molecular formula C7H3Cl3N2O3 and a molecular weight of 269.47 g/mol. Its IUPAC name is N-(3,5-dichloro-4-nitrophenyl)carbamoyl chloride.
| Compound Name | N-(3,5-dichloro-4-nitrophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 22150912 |
| Molecular Formula | C7H3Cl3N2O3 |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 267.92 |
| IUPAC Name | N-(3,5-dichloro-4-nitrophenyl)carbamoyl chloride |
| SMILES | O=C(Cl)Nc1cc(Cl)c([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C7H3Cl3N2O3/c8-4-1-3(11-7(10)13)2-5(9)6(4)12(14)15/h1-2H,(H,11,13) |
| InChIKey | WWXBZUJKSZOICH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|