C7H3ClF3NO — CID 135378921
N-(2,3,6-trifluorophenyl)carbamoyl chloride (PubChem CID 135378921) has the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. Its IUPAC name is N-(2,3,6-trifluorophenyl)carbamoyl chloride.
| Compound Name | N-(2,3,6-trifluorophenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 135378921 |
| Molecular Formula | C7H3ClF3NO |
| Molecular Weight | 209.55 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | N-(2,3,6-trifluorophenyl)carbamoyl chloride |
| SMILES | O=C(Cl)Nc1c(F)ccc(F)c1F |
| InChI | InChI=1S/C7H3ClF3NO/c8-7(13)12-6-4(10)2-1-3(9)5(6)11/h1-2H,(H,12,13) |
| InChIKey | DPFOCCAZVBSEPP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|