C6H3ClF3N — CID 174856597
N-chloro-2,3,6-trifluoroaniline (PubChem CID 174856597) has the molecular formula C6H3ClF3N and a molecular weight of 181.54 g/mol. Its IUPAC name is N-chloro-2,3,6-trifluoroaniline.
| Compound Name | N-chloro-2,3,6-trifluoroaniline |
|---|---|
| PubChem CID | 174856597 |
| Molecular Formula | C6H3ClF3N |
| Molecular Weight | 181.54 g/mol |
| Exact Mass | 180.99 |
| IUPAC Name | N-chloro-2,3,6-trifluoroaniline |
| SMILES | Fc1ccc(F)c(NCl)c1F |
| InChI | InChI=1S/C6H3ClF3N/c7-11-6-4(9)2-1-3(8)5(6)10/h1-2,11H |
| InChIKey | HGDVMQUUGKPJJE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|