C7H3ClF3NO — CID 134506144
(1E)-2,3,4-trifluoro-N-hydroxybenzenecarboximidoyl chloride (PubChem CID 134506144) has the molecular formula C7H3ClF3NO and a molecular weight of 209.55 g/mol. Its IUPAC name is (1E)-2,3,4-trifluoro-N-hydroxybenzenecarboximidoyl chloride.
| Compound Name | (1E)-2,3,4-trifluoro-N-hydroxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 134506144 |
| Molecular Formula | C7H3ClF3NO |
| Molecular Weight | 209.55 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | (1E)-2,3,4-trifluoro-N-hydroxybenzenecarboximidoyl chloride |
| SMILES | O/N=C(/Cl)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H3ClF3NO/c8-7(12-13)3-1-2-4(9)6(11)5(3)10/h1-2,13H/b12-7+ |
| InChIKey | HIBXJIXVFMBFCX-KPKJPENVSA-N |
| XLogP | 2.48 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|