C7H3Cl3FNO — CID 126566494
(1Z)-3,4-dichloro-2-fluoro-N-hydroxybenzenecarboximidoyl chloride (PubChem CID 126566494) has the molecular formula C7H3Cl3FNO and a molecular weight of 242.46 g/mol. Its IUPAC name is (1Z)-3,4-dichloro-2-fluoro-N-hydroxybenzenecarboximidoyl chloride.
| Compound Name | (1Z)-3,4-dichloro-2-fluoro-N-hydroxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 126566494 |
| Molecular Formula | C7H3Cl3FNO |
| Molecular Weight | 242.46 g/mol |
| Exact Mass | 240.93 |
| IUPAC Name | (1Z)-3,4-dichloro-2-fluoro-N-hydroxybenzenecarboximidoyl chloride |
| SMILES | O/N=C(\Cl)c1ccc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C7H3Cl3FNO/c8-4-2-1-3(7(10)12-13)6(11)5(4)9/h1-2,13H/b12-7- |
| InChIKey | TVHJUWFOOYKCLX-GHXNOFRVSA-N |
| XLogP | 3.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|