C8H6ClF2NO — CID 126578199
(1E)-2,3-difluoro-N-hydroxy-4-methylbenzenecarboximidoyl chloride (PubChem CID 126578199) has the molecular formula C8H6ClF2NO and a molecular weight of 205.59 g/mol. Its IUPAC name is (1E)-2,3-difluoro-N-hydroxy-4-methylbenzenecarboximidoyl chloride.
| Compound Name | (1E)-2,3-difluoro-N-hydroxy-4-methylbenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 126578199 |
| Molecular Formula | C8H6ClF2NO |
| Molecular Weight | 205.59 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | (1E)-2,3-difluoro-N-hydroxy-4-methylbenzenecarboximidoyl chloride |
| SMILES | Cc1ccc(/C(Cl)=N\O)c(F)c1F |
| InChI | InChI=1S/C8H6ClF2NO/c1-4-2-3-5(8(9)12-13)7(11)6(4)10/h2-3,13H,1H3/b12-8+ |
| InChIKey | NDIXYKFLDBVSLQ-XYOKQWHBSA-N |
| XLogP | 2.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|