C12H13ClF2 — CID 107514672
1-[(Z)-5-chloropent-2-en-2-yl]-2,3-difluoro-4-methylbenzene (PubChem CID 107514672) has the molecular formula C12H13ClF2 and a molecular weight of 230.68 g/mol. Its IUPAC name is 1-[(Z)-5-chloropent-2-en-2-yl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[(Z)-5-chloropent-2-en-2-yl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 107514672 |
| Molecular Formula | C12H13ClF2 |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[(Z)-5-chloropent-2-en-2-yl]-2,3-difluoro-4-methylbenzene |
| SMILES | C/C(=C/CCCl)c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C12H13ClF2/c1-8(4-3-7-13)10-6-5-9(2)11(14)12(10)15/h4-6H,3,7H2,1-2H3/b8-4- |
| InChIKey | PHAARYXOSDLJHR-YWEYNIOJSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|