C7H3Cl2F2NO — CID 140772329
3-chloro-2,4-difluoro-N-hydroxybenzenecarboximidoyl chloride (PubChem CID 140772329) has the molecular formula C7H3Cl2F2NO and a molecular weight of 226.01 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-hydroxybenzenecarboximidoyl chloride.
| Compound Name | 3-chloro-2,4-difluoro-N-hydroxybenzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 140772329 |
| Molecular Formula | C7H3Cl2F2NO |
| Molecular Weight | 226.01 g/mol |
| Exact Mass | 224.96 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-hydroxybenzenecarboximidoyl chloride |
| SMILES | ON=C(Cl)c1ccc(F)c(Cl)c1F |
| InChI | InChI=1S/C7H3Cl2F2NO/c8-5-4(10)2-1-3(6(5)11)7(9)12-13/h1-2,13H |
| InChIKey | GBIQCMGAXUZITD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.01 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|