C7H4F4S — CID 130935007
6-(difluoromethyl)-2,3-difluorobenzenethiol (PubChem CID 130935007) has the molecular formula C7H4F4S and a molecular weight of 196.17 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,3-difluorobenzenethiol.
| Compound Name | 6-(difluoromethyl)-2,3-difluorobenzenethiol |
|---|---|
| PubChem CID | 130935007 |
| Molecular Formula | C7H4F4S |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 6-(difluoromethyl)-2,3-difluorobenzenethiol |
| SMILES | Fc1ccc(C(F)F)c(S)c1F |
| InChI | InChI=1S/C7H4F4S/c8-4-2-1-3(7(10)11)6(12)5(4)9/h1-2,7,12H |
| InChIKey | INPGVAOJNZLJGX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|