About 6-(difluoromethyl)-2,3-difluorobenzenethiol
6-(difluoromethyl)-2,3-difluorobenzenethiol (PubChem CID 130935007) has the molecular formula C7H4F4S
and a molecular weight of 196.17 g/mol. Its IUPAC name is 6-(difluoromethyl)-2,3-difluorobenzenethiol.
Molecular Properties
| Compound Name | 6-(difluoromethyl)-2,3-difluorobenzenethiol |
| PubChem CID | 130935007 |
| Molecular Formula | C7H4F4S |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 6-(difluoromethyl)-2,3-difluorobenzenethiol |
| SMILES | Fc1ccc(C(F)F)c(S)c1F |
| InChI | InChI=1S/C7H4F4S/c8-4-2-1-3(7(10)11)6(12)5(4)9/h1-2,7,12H |
| InChIKey | INPGVAOJNZLJGX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(difluoromethyl)-2,3-difluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-2,3-difluorobenzenethiol?
The IUPAC name of 6-(difluoromethyl)-2,3-difluorobenzenethiol (CID 130935007) is 6-(difluoromethyl)-2,3-difluorobenzenethiol.
What is the SMILES notation for 6-(difluoromethyl)-2,3-difluorobenzenethiol?
The canonical SMILES for 6-(difluoromethyl)-2,3-difluorobenzenethiol is Fc1ccc(C(F)F)c(S)c1F.
What is the InChIKey of 6-(difluoromethyl)-2,3-difluorobenzenethiol?
The InChIKey is INPGVAOJNZLJGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4F4S/c8-4-2-1-3(7(10)11)6(12)5(4)9/h1-2,7,12H.
What are the key properties of 6-(difluoromethyl)-2,3-difluorobenzenethiol?
6-(difluoromethyl)-2,3-difluorobenzenethiol has a molecular weight of 196.17 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-2,3-difluorobenzenethiol is sourced from PubChem (CID 130935007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).