C6H6F6S — CID 173024870
2,3,4-trifluorobenzenethiol;trihydrofluoride (PubChem CID 173024870) has the molecular formula C6H6F6S and a molecular weight of 224.17 g/mol. Its IUPAC name is 2,3,4-trifluorobenzenethiol;trihydrofluoride.
| Compound Name | 2,3,4-trifluorobenzenethiol;trihydrofluoride |
|---|---|
| PubChem CID | 173024870 |
| Molecular Formula | C6H6F6S |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2,3,4-trifluorobenzenethiol;trihydrofluoride |
| SMILES | F.F.F.Fc1ccc(S)c(F)c1F |
| InChI | InChI=1S/C6H3F3S.3FH/c7-3-1-2-4(10)6(9)5(3)8;;;/h1-2,10H;3*1H |
| InChIKey | FCZCFXZGAMOXTR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|