About CID 173084587
CID 173084587 (PubChem CID 173084587) has the molecular formula C6H2F3Sb
and a molecular weight of 252.84 g/mol.
Molecular Properties
| Compound Name | CID 173084587 |
| PubChem CID | 173084587 |
| Molecular Formula | C6H2F3Sb |
| Molecular Weight | 252.84 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | — |
| SMILES | Fc1ccc([Sb])c(F)c1F |
| InChI | InChI=1S/C6H2F3.Sb/c7-4-2-1-3-5(8)6(4)9;/h1-2H; |
| InChIKey | JSKWOVUWCSOGED-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.84 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173084587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173084587?
The IUPAC name of CID 173084587 (CID 173084587) is not available.
What is the SMILES notation for CID 173084587?
The canonical SMILES for CID 173084587 is Fc1ccc([Sb])c(F)c1F.
What is the InChIKey of CID 173084587?
The InChIKey is JSKWOVUWCSOGED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2F3.Sb/c7-4-2-1-3-5(8)6(4)9;/h1-2H;.
What are the key properties of CID 173084587?
CID 173084587 has a molecular weight of 252.84 g/mol, XLogP of 0.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173084587 is sourced from PubChem (CID 173084587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).