C6H2F3I — CID 2779253
1,2,3-trifluoro-4-iodobenzene (PubChem CID 2779253) has the molecular formula C6H2F3I and a molecular weight of 257.98 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-iodobenzene.
| Compound Name | 1,2,3-trifluoro-4-iodobenzene |
|---|---|
| PubChem CID | 2779253 |
| Molecular Formula | C6H2F3I |
| Molecular Weight | 257.98 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 1,2,3-trifluoro-4-iodobenzene |
| SMILES | Fc1ccc(I)c(F)c1F |
| InChI | InChI=1S/C6H2F3I/c7-3-1-2-4(10)6(9)5(3)8/h1-2H |
| InChIKey | YDSUNVSIBZATIU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.98 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|