C8H4F5IO — CID 24774054
1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethanol (PubChem CID 24774054) has the molecular formula C8H4F5IO and a molecular weight of 338.01 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 24774054 |
| Molecular Formula | C8H4F5IO |
| Molecular Weight | 338.01 g/mol |
| Exact Mass | 337.92 |
| IUPAC Name | 1-(2,3-difluoro-4-iodophenyl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(I)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C8H4F5IO/c9-5-3(7(15)8(11,12)13)1-2-4(14)6(5)10/h1-2,7,15H |
| InChIKey | JUMZMDQRNAHUJM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|