C8H6F4IN — CID 66512623
(1S)-2,2,2-trifluoro-1-(4-fluoro-2-iodophenyl)ethanamine (PubChem CID 66512623) has the molecular formula C8H6F4IN and a molecular weight of 319.04 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(4-fluoro-2-iodophenyl)ethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-(4-fluoro-2-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 66512623 |
| Molecular Formula | C8H6F4IN |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(4-fluoro-2-iodophenyl)ethanamine |
| SMILES | N[C@@H](c1ccc(F)cc1I)C(F)(F)F |
| InChI | InChI=1S/C8H6F4IN/c9-4-1-2-5(6(13)3-4)7(14)8(10,11)12/h1-3,7H,14H2/t7-/m0/s1 |
| InChIKey | DUOHMZASLWJVEP-ZETCQYMHSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|