C8H6BrF3IN — CID 131123838
(1R)-1-(5-bromo-2-iodophenyl)-2,2,2-trifluoroethanamine (PubChem CID 131123838) has the molecular formula C8H6BrF3IN and a molecular weight of 379.95 g/mol. Its IUPAC name is (1R)-1-(5-bromo-2-iodophenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1R)-1-(5-bromo-2-iodophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 131123838 |
| Molecular Formula | C8H6BrF3IN |
| Molecular Weight | 379.95 g/mol |
| Exact Mass | 378.87 |
| IUPAC Name | (1R)-1-(5-bromo-2-iodophenyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@H](c1cc(Br)ccc1I)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF3IN/c9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3,7H,14H2/t7-/m1/s1 |
| InChIKey | LRMQAWVVFYKWAA-SSDOTTSWSA-N |
| XLogP | 3.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.95 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|