C6H5BrF3NS — CID 130648455
(1S)-1-(2-bromothiophen-3-yl)-2,2,2-trifluoroethanamine (PubChem CID 130648455) has the molecular formula C6H5BrF3NS and a molecular weight of 260.08 g/mol. Its IUPAC name is (1S)-1-(2-bromothiophen-3-yl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(2-bromothiophen-3-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130648455 |
| Molecular Formula | C6H5BrF3NS |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.93 |
| IUPAC Name | (1S)-1-(2-bromothiophen-3-yl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1ccsc1Br)C(F)(F)F |
| InChI | InChI=1S/C6H5BrF3NS/c7-5-3(1-2-12-5)4(11)6(8,9)10/h1-2,4H,11H2/t4-/m0/s1 |
| InChIKey | UIKHCYREJFCYOV-BYPYZUCNSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |