C6H5BrF3NO — CID 130655112
(1R)-1-(4-bromofuran-3-yl)-2,2,2-trifluoroethanamine (PubChem CID 130655112) has the molecular formula C6H5BrF3NO and a molecular weight of 244.01 g/mol. Its IUPAC name is (1R)-1-(4-bromofuran-3-yl)-2,2,2-trifluoroethanamine.
| Compound Name | (1R)-1-(4-bromofuran-3-yl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130655112 |
| Molecular Formula | C6H5BrF3NO |
| Molecular Weight | 244.01 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | (1R)-1-(4-bromofuran-3-yl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@H](c1cocc1Br)C(F)(F)F |
| InChI | InChI=1S/C6H5BrF3NO/c7-4-2-12-1-3(4)5(11)6(8,9)10/h1-2,5H,11H2/t5-/m1/s1 |
| InChIKey | OYWIFVJWGMCYSZ-RXMQYKEDSA-N |
| XLogP | 2.60 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.01 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |