About (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine
(1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine (PubChem CID 130612590) has the molecular formula C6H5F4NO
and a molecular weight of 183.10 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine.
Analyze (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine?
The IUPAC name of (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine (CID 130612590) is (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine.
What is the SMILES notation for (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine?
The canonical SMILES for (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine is N[C@H](c1cocc1F)C(F)(F)F.
What is the InChIKey of (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine?
The InChIKey is ORSQKJWEZXGJQV-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H5F4NO/c7-4-2-12-1-3(4)5(11)6(8,9)10/h1-2,5H,11H2/t5-/m1/s1.
What are the key properties of (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine?
(1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine has a molecular weight of 183.10 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2,2-trifluoro-1-(4-fluorofuran-3-yl)ethanamine is sourced from PubChem (CID 130612590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).