C7H5BrF5NS — CID 131352754
(1S)-1-(3-bromothiophen-2-yl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 131352754) has the molecular formula C7H5BrF5NS and a molecular weight of 310.09 g/mol. Its IUPAC name is (1S)-1-(3-bromothiophen-2-yl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | (1S)-1-(3-bromothiophen-2-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 131352754 |
| Molecular Formula | C7H5BrF5NS |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 308.92 |
| IUPAC Name | (1S)-1-(3-bromothiophen-2-yl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | N[C@H](c1sccc1Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5BrF5NS/c8-3-1-2-15-4(3)5(14)6(9,10)7(11,12)13/h1-2,5H,14H2/t5-/m1/s1 |
| InChIKey | OTRDUGOGEYRTHA-RXMQYKEDSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|