C7H4BrClF4S — CID 80537320
3-bromo-2-(1-chloro-2,2,3,3-tetrafluoropropyl)thiophene (PubChem CID 80537320) has the molecular formula C7H4BrClF4S and a molecular weight of 311.53 g/mol. Its IUPAC name is 3-bromo-2-(1-chloro-2,2,3,3-tetrafluoropropyl)thiophene.
| Compound Name | 3-bromo-2-(1-chloro-2,2,3,3-tetrafluoropropyl)thiophene |
|---|---|
| PubChem CID | 80537320 |
| Molecular Formula | C7H4BrClF4S |
| Molecular Weight | 311.53 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | 3-bromo-2-(1-chloro-2,2,3,3-tetrafluoropropyl)thiophene |
| SMILES | FC(F)C(F)(F)C(Cl)c1sccc1Br |
| InChI | InChI=1S/C7H4BrClF4S/c8-3-1-2-14-4(3)5(9)7(12,13)6(10)11/h1-2,5-6H |
| InChIKey | MZMYGWMNSNYCII-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|