C8H6BrClF3N — CID 130667190
(1S)-1-(2-bromo-3-chlorophenyl)-2,2,2-trifluoroethanamine (PubChem CID 130667190) has the molecular formula C8H6BrClF3N and a molecular weight of 288.49 g/mol. Its IUPAC name is (1S)-1-(2-bromo-3-chlorophenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(2-bromo-3-chlorophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130667190 |
| Molecular Formula | C8H6BrClF3N |
| Molecular Weight | 288.49 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | (1S)-1-(2-bromo-3-chlorophenyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1cccc(Cl)c1Br)C(F)(F)F |
| InChI | InChI=1S/C8H6BrClF3N/c9-6-4(2-1-3-5(6)10)7(14)8(11,12)13/h1-3,7H,14H2/t7-/m0/s1 |
| InChIKey | GIAVWERHAFIWCW-ZETCQYMHSA-N |
| XLogP | 3.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |