C7H5Br2F3N2 — CID 130618199
(1S)-1-(2,3-dibromo-4-pyridinyl)-2,2,2-trifluoroethanamine (PubChem CID 130618199) has the molecular formula C7H5Br2F3N2 and a molecular weight of 333.93 g/mol. Its IUPAC name is (1S)-1-(2,3-dibromo-4-pyridinyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(2,3-dibromo-4-pyridinyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 130618199 |
| Molecular Formula | C7H5Br2F3N2 |
| Molecular Weight | 333.93 g/mol |
| Exact Mass | 331.88 |
| IUPAC Name | (1S)-1-(2,3-dibromo-4-pyridinyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1ccnc(Br)c1Br)C(F)(F)F |
| InChI | InChI=1S/C7H5Br2F3N2/c8-4-3(1-2-14-6(4)9)5(13)7(10,11)12/h1-2,5H,13H2/t5-/m0/s1 |
| InChIKey | SNKGPCITFQETDO-YFKPBYRVSA-N |
| XLogP | 3.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.93 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|