C10H8F3N3 — CID 66510215
(1S)-2,2,2-trifluoro-1-quinoxalin-5-ylethanamine (PubChem CID 66510215) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-quinoxalin-5-ylethanamine.
| Compound Name | (1S)-2,2,2-trifluoro-1-quinoxalin-5-ylethanamine |
|---|---|
| PubChem CID | 66510215 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-quinoxalin-5-ylethanamine |
| SMILES | N[C@@H](c1cccc2nccnc12)C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3/c11-10(12,13)9(14)6-2-1-3-7-8(6)16-5-4-15-7/h1-5,9H,14H2/t9-/m0/s1 |
| InChIKey | CYCCUTCLIAAUKW-VIFPVBQESA-N |
| XLogP | 2.19 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |