C8H7F2I — CID 149278031
2-ethyl-1,3-difluoro-4-iodobenzene (PubChem CID 149278031) has the molecular formula C8H7F2I and a molecular weight of 268.04 g/mol. Its IUPAC name is 2-ethyl-1,3-difluoro-4-iodobenzene.
| Compound Name | 2-ethyl-1,3-difluoro-4-iodobenzene |
|---|---|
| PubChem CID | 149278031 |
| Molecular Formula | C8H7F2I |
| Molecular Weight | 268.04 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 2-ethyl-1,3-difluoro-4-iodobenzene |
| SMILES | CCc1c(F)ccc(I)c1F |
| InChI | InChI=1S/C8H7F2I/c1-2-5-6(9)3-4-7(11)8(5)10/h3-4H,2H2,1H3 |
| InChIKey | XSKAUTBUXGIHNI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.04 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|