C8H6Cl2FI — CID 163849495
1,3-dichloro-2-ethyl-4-fluoro-5-iodobenzene (PubChem CID 163849495) has the molecular formula C8H6Cl2FI and a molecular weight of 318.94 g/mol. Its IUPAC name is 1,3-dichloro-2-ethyl-4-fluoro-5-iodobenzene.
| Compound Name | 1,3-dichloro-2-ethyl-4-fluoro-5-iodobenzene |
|---|---|
| PubChem CID | 163849495 |
| Molecular Formula | C8H6Cl2FI |
| Molecular Weight | 318.94 g/mol |
| Exact Mass | 317.89 |
| IUPAC Name | 1,3-dichloro-2-ethyl-4-fluoro-5-iodobenzene |
| SMILES | CCc1c(Cl)cc(I)c(F)c1Cl |
| InChI | InChI=1S/C8H6Cl2FI/c1-2-4-5(9)3-6(12)8(11)7(4)10/h3H,2H2,1H3 |
| InChIKey | OTCLJPHBVLCBDQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.94 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|