C8H9Cl2NO — CID 11769652
6-amino-2,4-dichloro-3-ethylphenol (PubChem CID 11769652) has the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. Its IUPAC name is 6-amino-2,4-dichloro-3-ethylphenol.
| Compound Name | 6-amino-2,4-dichloro-3-ethylphenol |
|---|---|
| PubChem CID | 11769652 |
| Molecular Formula | C8H9Cl2NO |
| Molecular Weight | 206.07 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | 6-amino-2,4-dichloro-3-ethylphenol |
| SMILES | CCc1c(Cl)cc(N)c(O)c1Cl |
| InChI | InChI=1S/C8H9Cl2NO/c1-2-4-5(9)3-6(11)8(12)7(4)10/h3,12H,2,11H2,1H3 |
| InChIKey | QMRQXLFENCRBNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.07 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|