C13H7ClF3IO — CID 103216802
(3-chloro-4-iodophenyl)-(2,3,4-trifluorophenyl)methanol (PubChem CID 103216802) has the molecular formula C13H7ClF3IO and a molecular weight of 398.55 g/mol. Its IUPAC name is (3-chloro-4-iodophenyl)-(2,3,4-trifluorophenyl)methanol.
| Compound Name | (3-chloro-4-iodophenyl)-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 103216802 |
| Molecular Formula | C13H7ClF3IO |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | (3-chloro-4-iodophenyl)-(2,3,4-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(I)c(Cl)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7ClF3IO/c14-8-5-6(1-4-10(8)18)13(19)7-2-3-9(15)12(17)11(7)16/h1-5,13,19H |
| InChIKey | WMQPOOMRQZIXBO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|